* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | H-SER-LEU-OH |
| CAS: | 6665-16-3 |
| EnglishSynonyms: | L-SER-LEU ; SER-LEU ; H-SER-LEU-OH |
| pro_mdlNumber: | MFCD00055934 |
| pro_acceptors: | 6 |
| pro_donors: | 4 |
| pro_smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
| InChi: | InChI=1S/C9H18N2O4/c1-5(2)3-7(9(14)15)11-8(13)6(10)4-12/h5-7,12H,3-4,10H2,1-2H3,(H,11,13)(H,14,15)/t6-,7-/m0/s1 |
| InChiKey: | InChIKey=NFDYGNFETJVMSE-BQBZGAKWSA-N |
|
|
| Comments: | CRYSTALLINE |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.