* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | H-ARG-ASN-NH2 SULFATE SALT |
| CAS: | 68040-98-2 |
| EnglishSynonyms: | H-ARG-ASN-NH2 SULFATE SALT |
| pro_mdlNumber: | MFCD03788119 |
| pro_acceptors: | 10 |
| pro_donors: | 7 |
| pro_smile: | C(C[C@@H](C(=O)N[C@@H](CC(=O)N)C(=O)N)N)CNC(=N)N.OS(=O)(=O)O |
| InChi: | InChI=1S/C10H21N7O3.H2O4S/c11-5(2-1-3-16-10(14)15)9(20)17-6(8(13)19)4-7(12)18;1-5(2,3)4/h5-6H,1-4,11H2,(H2,12,18)(H2,13,19)(H,17,20)(H4,14,15,16);(H2,1,2,3,4)/t5-,6-;/m0./s1 |
| InChiKey: | InChIKey=MKCCXGIXIARNIX-GEMLJDPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.