* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-MANNOSE-2-13C |
| CAS: | 70849-16-0 |
| EnglishSynonyms: | D-MANNOSE-2-13C ; D-[2-13C]MANNOSE |
| pro_mdlNumber: | MFCD00084010 |
| pro_acceptors: | 6 |
| pro_donors: | 5 |
| pro_smile: | C([C@@H]1[C@H]([C@@H]([13C@@H](C(O1)O)O)O)O)O |
| InChi: | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6?/m1/s1/i5+1 |
| InChiKey: | InChIKey=WQZGKKKJIJFFOK-JJELKLASSA-N |
|
|
| MeltingPoint: | 133 DEG C(LIT) |
| Comments: | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]20/D +14.5 DEG, C = 1 IN H2O |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 181.15 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.