* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 14-ACETYLVIRESCENINE |
| CAS: | 71609-79-5 |
| EnglishSynonyms: | 14-ACETYLVIRESCENINE |
| pro_mdlNumber: | MFCD00274515 |
| pro_acceptors: | 8 |
| pro_donors: | 3 |
| pro_smile: | CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2C[C@@](C31)([C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6OC(=O)C)OC)O)O)O)COC |
| InChi: | InChI=1S/C25H39NO7/c1-5-26-11-22(12-31-3)7-6-18(28)25-15-8-14-16(32-4)9-23(29,19(15)20(14)33-13(2)27)24(30,21(25)26)10-17(22)25/h14-21,28-30H,5-12H2,1-4H3/t14-,15-,16+,17-,18+,19-,20+,21?,22+,23-,24-,25-/m1/s1 |
| InChiKey: | InChIKey=QAFUNFQLCIKXQS-WODLYVHESA-N |
|
|
| Information: | 465 DA |
|
|
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.