* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | BICYCLO[3.2.1]OCTAN-8-OL,1,5-DIMETHYL-, FORMATE, SYN- |
CAS: | 72903-06-1 |
EnglishSynonyms: | BICYCLO[3.2.1]OCTAN-8-OL,1,5-DIMETHYL-, FORMATE, SYN- |
pro_mdlNumber: | MFCD21608058 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | C[C@]12CCC[C@]([C@@H]1OC=O)(CC2)C |
InChi: | InChI=1S/C11H18O2/c1-10-4-3-5-11(2,7-6-10)9(10)13-8-12/h8-9H,3-7H2,1-2H3/t9-,10-,11+ |
InChiKey: | InChIKey=WDZYJGQARPJWOY-RTCCRHLQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.