* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 6-AMINO-TRYPTOPHAN |
CAS: | 7303-52-8 |
EnglishSynonyms: | ABLOCK AB-11-3647 ; 6-AMINO-TRYPTOPHAN ; TRYPTOPHAN, 6-AMINO- |
pro_mdlNumber: | MFCD17170089 |
pro_acceptors: | 5 |
pro_donors: | 4 |
pro_smile: | c1cc2c(cc1N)[nH]cc2CC(C(=O)O)N |
InChi: | InChI=1S/C11H13N3O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,12-13H2,(H,15,16) |
InChiKey: | InChIKey=URBHVZVPIHGYBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.