* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 4-AMINO-5-(2-FURYL)-4H-1,2,4-TRIAZOLE-3-THIOL |
| CAS: | 80809-38-7 |
| EnglishSynonyms: | 4-AMINO-5-(2-FURYL)-1,2,4-TRIAZOLE-3-THIOL ; 4-AMINO-5-(2-FURYL)-4H-1,2,4-TRIAZOLE-3-THIOL ; 4-AMINO-5-(FURAN-2-YL)-1,2,4-TRIAZOLE-3-THIOL ; 4-AMINO-5-(FURAN-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL ; BUTTPARK 100\07-61 ; 4-AMINO-5-(2-FURYL)-4H-1,2,4-TRIAZOL-3-YL HYDROSULFIDE ; 4H-1,2,4-TRIAZOLE-3-THIOL, 4-AMINO-5-(2-FURANYL)- |
| pro_mdlNumber: | MFCD03044388 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | c1cc(oc1)c2nnc(n2N)S |
| InChi: | InChI=1S/C6H6N4OS/c7-10-5(8-9-6(10)12)4-2-1-3-11-4/h1-3H,7H2,(H,9,12) |
| InChiKey: | InChIKey=XLYBWYJEEHPZMQ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.