* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 5-AMINOISOXAZOL-3(2H)-ONE |
| CAS: | 822-63-9 |
| EnglishSynonyms: | 5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE ; 5-AMINOISOXAZOL-3(2H)-ONE ; 5-AMINO-ISOXAZOL-3-ONE |
| pro_mdlNumber: | MFCD00047072 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1c(o[nH]c1=O)N |
| InChi: | InChI=1S/C3H4N2O2/c4-2-1-3(6)5-7-2/h1H,4H2,(H,5,6) |
| InChiKey: | InChIKey=SBAQXOKGHJGIGF-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.