* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | PF 915275 |
CAS: | 857290-04-1 |
EnglishSynonyms: | PF 915275 ; N-(6-AMINOPYRIDIN-2-YL)-4'-CYANOBIPHENYL-4-SULFONAMIDE |
pro_mdlNumber: | MFCD12828758 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | c1cc(nc(c1)NS(=O)(=O)c2ccc(cc2)c3ccc(cc3)C#N)N |
InChi: | InChI=1S/C18H14N4O2S/c19-12-13-4-6-14(7-5-13)15-8-10-16(11-9-15)25(23,24)22-18-3-1-2-17(20)21-18/h1-11H,(H3,20,21,22) |
InChiKey: | InChIKey=ZESFDAKNYJQYKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.