* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | BROMOACETIC ACID-18O2 |
| CAS: | 857291-01-1 |
| EnglishSynonyms: | BROMOACETIC ACID-18O2 |
| pro_mdlNumber: | MFCD08702816 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C(C(=[18O])[18OH])Br |
| InChi: | InChI=1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5)/i4+2,5+2 |
| InChiKey: | InChIKey=KDPAWGWELVVRCH-MABBKULESA-N |
|
|
| MeltingPoint: | 47-49 DEG C(LIT) |
| Boiling_Point: | 208 DEG C(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+4 RIDADR: UN 3425 8/PG 2 WGK: 3 |
| Information: | ISOTOPIC PURITY: 95 ATOM % 18O MW: 142.75 BY ATOM % CALCULATION |
|
|
| secure_symbol: |
GHS05
GHS06
GHS09
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H301-H311-H314-H317-H331-H400 |
| secure_cautionary_stmt: | P261-P273-P280-P301 + P310-P305 + P351 + P338-P310 |
| secure_damage_code: | T,C,N |
| secure_risk_disclosure_stmt: | R:23/24/25-35-43-50 |
| secure_security_stmt: | S:26-36/37/39-45-61 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.