* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 8-(5-NITROPYRIDIN-2-YL)-1,4-DIOXA-8-AZASPIRO[4.5]DECANE |
CAS: | 877790-46-0 |
EnglishSynonyms: | 8-(5-NITROPYRIDIN-2-YL)-1,4-DIOXA-8-AZASPIRO[4.5]DECANE ; ABLOCK AB-13-4146 |
pro_mdlNumber: | MFCD05702090 |
pro_acceptors: | 7 |
pro_donors: | 0 |
pro_smile: | c1cc(ncc1[N+](=O)[O-])N2CCC3(CC2)OCCO3 |
InChi: | InChI=1S/C12H15N3O4/c16-15(17)10-1-2-11(13-9-10)14-5-3-12(4-6-14)18-7-8-19-12/h1-2,9H,3-8H2 |
InChiKey: | InChIKey=NMLMJCKWDMDLTR-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.