* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 5-(2,5-DICHLOROPHENYL)-1,2,4-TRIAZIN-3-AMINE |
CAS: | 886497-17-2 |
EnglishSynonyms: | 5-(2,5-DICHLOROPHENYL)-1,2,4-TRIAZIN-3-AMINE ; 5-(2,5-DICHLORO-PHENYL)-[1,2,4]TRIAZIN-3-YLAMINE |
pro_mdlNumber: | MFCD06739753 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | c1cc(c(cc1Cl)c2cnnc(n2)N)Cl |
InChi: | InChI=1S/C9H6Cl2N4/c10-5-1-2-7(11)6(3-5)8-4-13-15-9(12)14-8/h1-4H,(H2,12,14,15) |
InChiKey: | InChIKey=LRPJNRNMMDWCBM-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.