* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 3-(5-PIPERIDIN-3-YL-1,2,4-OXADIAZOL-3-YL)PYRIDINE |
| CAS: | 915924-54-8 |
| EnglishSynonyms: | 3-(5-PIPERIDIN-3-YL-1,2,4-OXADIAZOL-3-YL)PYRIDINE ; 5-(PIPERIDIN-3-YL)-3-(PYRIDIN-3-YL)-1,2,4-OXADIAZOLE ; 5-(3-PIPERIDYL)-3-(3-PYRIDYL)-1,2,4-OXADIAZOLE ; ABBYPHARMA AP-31-3197 |
| pro_mdlNumber: | MFCD08691548 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | c1cc(cnc1)c2nc(on2)C3CCCNC3 |
| InChi: | InChI=1S/C12H14N4O/c1-3-9(7-13-5-1)11-15-12(17-16-11)10-4-2-6-14-8-10/h1,3,5,7,10,14H,2,4,6,8H2 |
| InChiKey: | InChIKey=WJABBJUGFLNJQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.