* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 1H-PYRROLO[2,3-B]PYRIDINE, 4-BROMO-5-CHLORO-, 7-OXIDE |
| CAS: | 916176-86-8 |
| EnglishSynonyms: | 1H-PYRROLO[2,3-B]PYRIDINE, 4-BROMO-5-CHLORO-, 7-OXIDE |
| pro_mdlNumber: | MFCD16039092 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | c1c[nH]c2c1c(c(c[n+]2[O-])Cl)Br |
| InChi: | InChI=1S/C7H4BrClN2O/c8-6-4-1-2-10-7(4)11(12)3-5(6)9/h1-3,10H |
| InChiKey: | InChIKey=HRRXIVKHSOYCCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.