* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 4-(3-BROMOTHIEN-2-YL)BENZOIC ACID |
| CAS: | 930111-09-4 |
| EnglishSynonyms: | 4-(3-BROMOTHIEN-2-YL)BENZOIC ACID |
| pro_mdlNumber: | MFCD09879966 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1cc(ccc1c2c(ccs2)Br)C(=O)O |
| InChi: | InChI=1S/C11H7BrO2S/c12-9-5-6-15-10(9)7-1-3-8(4-2-7)11(13)14/h1-6H,(H,13,14) |
| InChiKey: | InChIKey=WAOAWGITQLHUFM-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 228.5-229.5 DEG C |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.