* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 2,2-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOTHIAZINE |
| CAS: | 93301-19-0 |
| EnglishSynonyms: | 2,2-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOTHIAZINE |
| pro_mdlNumber: | MFCD16471298 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CC1(CNc2ccccc2S1)C |
| InChi: | InChI=1S/C10H13NS/c1-10(2)7-11-8-5-3-4-6-9(8)12-10/h3-6,11H,7H2,1-2H3 |
| InChiKey: | InChIKey=QYSQMZALWJWGLW-UHFFFAOYSA-N |
|
|
| Comments: | HAZARD: R 36/37/38 HAZARD: S 26-37-60 TSCA: N UNSPSC: 12000000 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.