* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 5-HEPTENOIC ACID, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-DIFLUORO-4-PHENOXY-1-BUTEN-1-YL]-3,5-DIHYDROXYCYCLOPENTYL]-, ION(1-), (5Z)- |
| CAS: | 959851-12-8 |
| EnglishSynonyms: | 5-HEPTENOIC ACID, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-DIFLUORO-4-PHENOXY-1-BUTEN-1-YL]-3,5-DIHYDROXYCYCLOPENTYL]-, ION(1-), (5Z)- |
| pro_mdlNumber: | MFCD17019356 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | O[C@H]1C[C@@H](O)[C@H](\C=C\C(F)(F)COC2=CC=CC=C2)[C@H]1C\C=C/CCCC([O-])=O |
| InChi: | InChI=1S/C22H28F2O5/c23-22(24,15-29-16-8-4-3-5-9-16)13-12-18-17(19(25)14-20(18)26)10-6-1-2-7-11-21(27)28/h1,3-6,8-9,12-13,17-20,25-26H,2,7,10-11,14-15H2,(H,27,28)/p-1/b6-1-,13-12+/t17-,18-,19+,20-/m1/s1 |
| InChiKey: | InChIKey=KIQXRQVVYTYYAZ-VKVYFNERSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.