* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ADENINE-1,3-15N2 |
| CAS: | 97908-71-9 |
| EnglishSynonyms: | ADENINE-1,3-15N2 ; 6-AMINOPURINE-15N2 ; VITAMIN B4-15N2 |
| pro_mdlNumber: | MFCD00213651 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | c1[nH]c2c(n1)c([15n]c[15n]2)N |
| InChi: | InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)/i8+1,10+1 |
| InChiKey: | InChIKey=GFFGJBXGBJISGV-GAWGKFCISA-N |
|
|
| MeltingPoint: | 360-365 DEG C (SUBL)(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+2 WGK: 3 |
| Information: | ISOTOPIC PURITY: 98 ATOM % 15N MW: 137.08 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.