* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | GANODERIC ACID C2 |
CAS: | 98296-48-1 ;103773-62-2 |
EnglishSynonyms: | GANODERIC ACID C2 |
pro_mdlNumber: | MFCD04039842 |
pro_acceptors: | 7 |
pro_donors: | 4 |
pro_smile: | C[C@H](CC(=O)C[C@@H](C)C(=O)O)[C@H]1C[C@@H]([C@@]2([C@@]1(CC(=O)C3=C2[C@H](C[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)O)C)C)O |
InChi: | InChI=1S/C30H46O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21-23,32,34-35H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,22+,23+,28+,29-,30+/m1/s1 |
InChiKey: | InChIKey=RERVSJVGWKIGTJ-RQLZKMEDSA-N |
property |
|
MeltingPoint: | 231-232 DEG C |
Specification: | PRIMARY STANDARD |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.