* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ETHANONE, 1-(1-NITRO-1H-PYRROL-2-YL)- |
| CAS: | 158366-45-1 |
| EnglishSynonyms: | ETHANONE, 1-(1-NITRO-1H-PYRROL-2-YL)- ; 1-(1-NITRO-1H-PYRROL-2-YL)-ETHANONE ; 1-(1-NITRO-1H-PYRROL-2-YL)ETHAN-1-ONE |
| pro_mdlNumber: | MFCD01727412 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | CC(=O)c1cccn1[N+](=O)[O-] |
| InChi: | InChI=1S/C6H6N2O3/c1-5(9)6-3-2-4-7(6)8(10)11/h2-4H,1H3 |
| InChiKey: | InChIKey=IAWKNFOCXFSSLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.