* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | XYLOSE D [1-14C] |
CAS: | 19588-10-4 |
EnglishSynonyms: | XYLOSE D [1-14C] |
pro_mdlNumber: | MFCD00190084 |
pro_acceptors: | 5 |
pro_donors: | 4 |
pro_smile: | C([C@@H]1[C@@H]([C@H]([14CH](O1)O)O)O)O |
InChi: | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5?/m1/s1/i5+2 |
InChiKey: | InChIKey=HMFHBZSHGGEWLO-INIWLDRFSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.