* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | O-TOLUIC-D7 ACID |
| CAS: | 207742-73-2 |
| EnglishSynonyms: | 2-METHYLBENZOIC ACID-D7 ; O-TOLUIC-D7 ACID |
| pro_mdlNumber: | MFCD00002478 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | [2H]C1=C([2H])C(C(O)=O)=C(C([2H])=C1[2H])C([2H])([2H])[2H] |
| InChi: | InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10)/i1D3,2D,3D,4D,5D |
| InChiKey: | InChIKey=ZWLPBLYKEWSWPD-AAYPNNLASA-N |
|
|
| Information: | 98 ATOM % D |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.