* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | 1H-INDENE, 7-(1-METHYLETHYL)- |
CAS: | 535969-39-2 |
EnglishSynonyms: | 1H-INDENE, 7-(1-METHYLETHYL)- ; 7-(PROPAN-2-YL)-1H-INDENE ; 7-(1-METHYLETHYL)-1H-INDENE |
pro_mdlNumber: | MFCD18808893 |
pro_acceptors: | 0 |
pro_donors: | 0 |
pro_smile: | CC(C)c1cccc2c1CC=C2 |
InChi: | InChI=1S/C12H14/c1-9(2)11-7-3-5-10-6-4-8-12(10)11/h3-7,9H,8H2,1-2H3 |
InChiKey: | InChIKey=PZJUBJNOLXWGGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.