* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | JNJ 10397049 |
CAS: | 708275-58-5 |
EnglishSynonyms: | 1-(2,4-DIBROMO-PHENYL)-3-((4S,5S)-2,2-DIMETHYL-4-PHENYL-[1,3]DIOXAN-5-YL)UREA ; JNJ 10397049 |
pro_mdlNumber: | MFCD17170315 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | CC1(OC[C@@H]([C@@H](O1)c2ccccc2)NC(=O)Nc3ccc(cc3Br)Br)C |
InChi: | InChI=1S/C19H20Br2N2O3/c1-19(2)25-11-16(17(26-19)12-6-4-3-5-7-12)23-18(24)22-15-9-8-13(20)10-14(15)21/h3-10,16-17H,11H2,1-2H3,(H2,22,23,24)/t16-,17-/m0/s1 |
InChiKey: | InChIKey=RBKIJGLHFFQHBE-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.