* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 4-(4-METHOXYPHENYL)-5-METHYL-2,4-DIHYDRO-3H-1,2,4-TRIAZOL-3-ONE |
| CAS: | 85562-69-2 |
| EnglishSynonyms: | 2,4-DIHYDRO-4-(4-METHOXYPHENYL)-5-METHYL-3H-1,2,4-TRIAZOL-3-ONE ; 4-(4-METHOXYPHENYL)-5-METHYL-2,4-DIHYDRO-3H-1,2,4-TRIAZOL-3-ONE |
| pro_mdlNumber: | MFCD03787259 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | Cc1n[nH]c(=O)n1c2ccc(cc2)OC |
| InChi: | InChI=1S/C10H11N3O2/c1-7-11-12-10(14)13(7)8-3-5-9(15-2)6-4-8/h3-6H,1-2H3,(H,12,14) |
| InChiKey: | InChIKey=BCMPVLMAJYUGPT-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 204-205 DEG |
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.