* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ANILINE-13C6 HYDROCHLORIDE |
| CAS: | 89059-38-1 |
| EnglishSynonyms: | ANILINE-13C6 HYDROCHLORIDE |
| pro_mdlNumber: | MFCD08702815 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | [13cH]1[13cH][13cH][13c]([13cH][13cH]1)N.Cl |
| InChi: | InChI=1S/C6H7N.ClH/c7-6-4-2-1-3-5-6;/h1-5H,7H2;1H/i1+1,2+1,3+1,4+1,5+1,6+1; |
| InChiKey: | InChIKey=MMCPOSDMTGQNKG-BVNCJLROSA-N |
|
|
| PhysicalProperty: | FLASHPOINT: 194 DEG C FLASHPOINT: 381.2 DEG F |
| Comments: | MASS SHIFT: M+6 RIDADR: UN 1548 6.1/PG 3 STORAGE TEMPERATURE: 2-8 DEG C WGK: 2 |
| Information: | ISOTOPIC PURITY: 99 ATOM% 13C MW: 135.49 BY ATOM% CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.