CIS-11,14-EICOSADIENOIC ACID ETHYL ESTER

pro_cas
103213-62-3
pro_cdbregno
CCD00038009
pro_formula
C22 H40 O2
pro_molWeight
336.556

basic_info

Product_Name: CIS-11,14-EICOSADIENOIC ACID ETHYL ESTER
CAS: 103213-62-3
EnglishSynonyms: CIS-11,14-EICOSADIENOIC ACID ETHYL ESTER
pro_mdlNumber: MFCD00056305
pro_acceptors: 2
pro_donors: 0
pro_smile: CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OCC
InChi: InChI=1S/C22H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h8-9,11-12H,3-7,10,13-21H2,1-2H3/b9-8+,12-11+
InChiKey: InChIKey=PYVCCFLKWCNDQZ-MVKOLZDDSA-N