H-ALA-VAL-OH

pro_cas
3303-45-5
pro_cdbregno
CCD00043683
pro_formula
C8 H16 N2 O3
pro_molWeight
188.225

basic_info

Product_Name: H-ALA-VAL-OH
CAS: 3303-45-5
EnglishSynonyms: L-ALANYL-L-VALINE ; H-ALA-VAL-OH ; ALA-VAL ; L-ALA-VAL ; ALA-VAL-OH
pro_mdlNumber: MFCD00066027
pro_acceptors: 5
pro_donors: 3
pro_smile: CC(C)[C@@H](C(=O)O)NC(=O)[C@H](C)N
InChi: InChI=1S/C8H16N2O3/c1-4(2)6(8(12)13)10-7(11)5(3)9/h4-6H,9H2,1-3H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1
InChiKey: InChIKey=LIWMQSWFLXEGMA-WDSKDSINSA-N

property

secure_info