AURORA KA-1250

pro_cas
pro_cdbregno
CCD00133981
pro_formula
C7H17O2P
pro_molWeight
164.183

basic_info

Product_Name: AURORA KA-1250
EnglishSynonyms: AURORA KA-1250
pro_mdlNumber: MFCD00460249
pro_acceptors: 2
pro_donors: 1
pro_smile: CCCCCCCP(O)=O
InChi: InChI=1S/C7H17O2P/c1-2-3-4-5-6-7-10(8)9/h10H,2-7H2,1H3,(H,8,9)
InChiKey: InChIKey=FKSZMYHHDBGDPM-UHFFFAOYSA-N