VITAS-BB TBB019004

pro_cas
pro_cdbregno
CCD00146305
pro_formula
C13H14N2O2
pro_molWeight
230.266

basic_info

Product_Name: VITAS-BB TBB019004
EnglishSynonyms: VITAS-BB TBB019004
pro_mdlNumber: MFCD00630918
pro_acceptors: 4
pro_donors: 0
pro_smile: COC(=O)C(=C/C1=CC=C(C=C1)N(C)C)\C#N
InChi: InChI=1S/C13H14N2O2/c1-15(2)12-6-4-10(5-7-12)8-11(9-14)13(16)17-3/h4-8H,1-3H3/b11-8-
InChiKey: InChIKey=PVTUXLIWSQLDRD-FLIBITNWSA-N