3-OXO-3-(3-PHENYL-5-ISOXAZOLYL)PROPANAL O-(4-CHLOROBENZYL)OXIME

pro_cas
pro_cdbregno
CCD00227785
pro_formula
C19 H15 Cl N2 O3
pro_molWeight
354.792

basic_info

Product_Name: 3-OXO-3-(3-PHENYL-5-ISOXAZOLYL)PROPANAL O-(4-CHLOROBENZYL)OXIME
EnglishSynonyms: 3-OXO-3-(3-PHENYL-5-ISOXAZOLYL)PROPANAL O-(4-CHLOROBENZYL)OXIME
pro_mdlNumber: MFCD01568785
pro_acceptors: 5
pro_donors: 0
pro_smile: c1ccc(cc1)c2cc(on2)C(=O)C/C=N/OCc3ccc(cc3)Cl
InChi: InChI=1S/C19H15ClN2O3/c20-16-8-6-14(7-9-16)13-24-21-11-10-18(23)19-12-17(22-25-19)15-4-2-1-3-5-15/h1-9,11-12H,10,13H2/b21-11+
InChiKey: InChIKey=HBPFOFJOWHBGCN-SRZZPIQSSA-N