8-(DIMETHYLAMINOMETHYL)-7-HYDROXY-2-METHYLISOFLAVONE HYDROCHLORIDE

pro_cas
67292-77-7
pro_cdbregno
CCD00245638
pro_formula
C19 H19 N O3 . Cl H
pro_molWeight
345.824

basic_info

Product_Name: 8-(DIMETHYLAMINOMETHYL)-7-HYDROXY-2-METHYLISOFLAVONE HYDROCHLORIDE
CAS: 67292-77-7
EnglishSynonyms: 8-(DIMETHYLAMINOMETHYL)-7-HYDROXY-2-METHYLISOFLAVONE HYDROCHLORIDE
pro_mdlNumber: MFCD01718093
pro_acceptors: 4
pro_donors: 1
pro_smile: Cc1c(c(=O)c2ccc(c(c2o1)CN(C)C)O)c3ccccc3.Cl
InChi: InChI=1S/C19H19NO3.ClH/c1-12-17(13-7-5-4-6-8-13)18(22)14-9-10-16(21)15(11-20(2)3)19(14)23-12;/h4-10,21H,11H2,1-3H3;1H
InChiKey: InChIKey=HBBLKDVQYGSOFQ-UHFFFAOYSA-N