7-HYDROXY-2-METHYL-8-(MORPHOLINOMETHYL)ISOFLAVONE HYDROCHLORIDE

pro_cas
67292-73-3
pro_cdbregno
CCD00245639
pro_formula
C21 H21 N O4 . Cl H
pro_molWeight
387.861

basic_info

Product_Name: 7-HYDROXY-2-METHYL-8-(MORPHOLINOMETHYL)ISOFLAVONE HYDROCHLORIDE
CAS: 67292-73-3
EnglishSynonyms: 7-HYDROXY-2-METHYL-8-(MORPHOLINOMETHYL)ISOFLAVONE HYDROCHLORIDE
pro_mdlNumber: MFCD01718094
pro_acceptors: 5
pro_donors: 1
pro_smile: Cc1c(c(=O)c2ccc(c(c2o1)CN3CCOCC3)O)c4ccccc4.Cl
InChi: InChI=1S/C21H21NO4.ClH/c1-14-19(15-5-3-2-4-6-15)20(24)16-7-8-18(23)17(21(16)26-14)13-22-9-11-25-12-10-22;/h2-8,23H,9-13H2,1H3;1H
InChiKey: InChIKey=NRNJPLBGKFXHAD-UHFFFAOYSA-N