7-HYDROXY-2-METHYL-8-(PIPERIDINOMETHYL)ISOFLAVONE HYDROCHLORIDE

pro_cas
67292-74-4
pro_cdbregno
CCD00245640
pro_formula
C22 H23 N O3 . Cl H
pro_molWeight
385.889

basic_info

Product_Name: 7-HYDROXY-2-METHYL-8-(PIPERIDINOMETHYL)ISOFLAVONE HYDROCHLORIDE
CAS: 67292-74-4
EnglishSynonyms: 7-HYDROXY-2-METHYL-8-(PIPERIDINOMETHYL)ISOFLAVONE HYDROCHLORIDE
pro_mdlNumber: MFCD01718095
pro_acceptors: 4
pro_donors: 1
pro_smile: Cc1c(c(=O)c2ccc(c(c2o1)CN3CCCCC3)O)c4ccccc4.Cl
InChi: InChI=1S/C22H23NO3.ClH/c1-15-20(16-8-4-2-5-9-16)21(25)17-10-11-19(24)18(22(17)26-15)14-23-12-6-3-7-13-23;/h2,4-5,8-11,24H,3,6-7,12-14H2,1H3;1H
InChiKey: InChIKey=YLUVIIUAOYMVEH-UHFFFAOYSA-N