4-FLUORO-N-(1-METHYL-1H-PYRAZOL-5-YL)BENZAMIDE

pro_cas
pro_cdbregno
CCD00253001
pro_formula
C11 H10 F N3 O
pro_molWeight
219.218

basic_info

Product_Name: 4-FLUORO-N-(1-METHYL-1H-PYRAZOL-5-YL)BENZAMIDE
EnglishSynonyms: 4-FLUORO-N-(1-METHYL-1H-PYRAZOL-5-YL)BENZAMIDE
pro_mdlNumber: MFCD01763723
pro_acceptors: 4
pro_donors: 1
pro_smile: Cn1c(ccn1)NC(=O)c2ccc(cc2)F
InChi: InChI=1S/C11H10FN3O/c1-15-10(6-7-13-15)14-11(16)8-2-4-9(12)5-3-8/h2-7H,1H3,(H,14,16)
InChiKey: InChIKey=DDUFQIKDMBBMFP-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.