4-((4-[(1,3-DIMETHYL-4,6-DIOXO-2-THIOXOTETRAHYDRO-5(2H)-PYRIMIDINYLIDENE)METHYL]-2-METHOXYPHENOXY)METHYL)BENZOIC ACID

pro_cas
pro_cdbregno
CCD00338605
pro_formula
C22 H20 N2 O6 S
pro_molWeight
440.474

basic_info

Product_Name: 4-((4-[(1,3-DIMETHYL-4,6-DIOXO-2-THIOXOTETRAHYDRO-5(2H)-PYRIMIDINYLIDENE)METHYL]-2-METHOXYPHENOXY)METHYL)BENZOIC ACID
EnglishSynonyms: 4-((4-[(1,3-DIMETHYL-4,6-DIOXO-2-THIOXOTETRAHYDRO-5(2H)-PYRIMIDINYLIDENE)METHYL]-2-METHOXYPHENOXY)METHYL)BENZOIC ACID
pro_mdlNumber: MFCD02779631
pro_acceptors: 8
pro_donors: 1
pro_smile: CN1C(=O)C(=Cc2ccc(c(c2)OC)OCc3ccc(cc3)C(=O)O)C(=O)N(C1=S)C
InChi: InChI=1S/C22H20N2O6S/c1-23-19(25)16(20(26)24(2)22(23)31)10-14-6-9-17(18(11-14)29-3)30-12-13-4-7-15(8-5-13)21(27)28/h4-11H,12H2,1-3H3,(H,27,28)
InChiKey: InChIKey=CFHQRDQAKAAPFA-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.