ETHYL (4-[(1,3-DIMETHYL-4,6-DIOXO-2-THIOXOTETRAHYDRO-5(2H)-PYRIMIDINYLIDENE)METHYL]-2-IODO-6-METHOXYPHENOXY)ACETATE

pro_cas
pro_cdbregno
CCD00338611
pro_formula
C18 H19 I N2 O6 S
pro_molWeight
518.322

basic_info

Product_Name: ETHYL (4-[(1,3-DIMETHYL-4,6-DIOXO-2-THIOXOTETRAHYDRO-5(2H)-PYRIMIDINYLIDENE)METHYL]-2-IODO-6-METHOXYPHENOXY)ACETATE
EnglishSynonyms: ETHYL (4-[(1,3-DIMETHYL-4,6-DIOXO-2-THIOXOTETRAHYDRO-5(2H)-PYRIMIDINYLIDENE)METHYL]-2-IODO-6-METHOXYPHENOXY)ACETATE
pro_mdlNumber: MFCD02779696
pro_acceptors: 8
pro_donors: 0
pro_smile: CCOC(=O)COc1c(cc(cc1I)C=C2C(=O)N(C(=S)N(C2=O)C)C)OC
InChi: InChI=1S/C18H19IN2O6S/c1-5-26-14(22)9-27-15-12(19)7-10(8-13(15)25-4)6-11-16(23)20(2)18(28)21(3)17(11)24/h6-8H,5,9H2,1-4H3
InChiKey: InChIKey=HWLMZFAAHAPORL-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.