6-[1-(4-CHLOROPHENYL)-1H-PYRAZOL-4-YL]-N-(2-FURYLMETHYL)NICOTINAMIDE

pro_cas
pro_cdbregno
CCD00402817
pro_formula
C20 H15 Cl N4 O2
pro_molWeight
378.818

basic_info

Product_Name: 6-[1-(4-CHLOROPHENYL)-1H-PYRAZOL-4-YL]-N-(2-FURYLMETHYL)NICOTINAMIDE
EnglishSynonyms: 6-[1-(4-CHLOROPHENYL)-1H-PYRAZOL-4-YL]-N-(2-FURYLMETHYL)NICOTINAMIDE
pro_mdlNumber: MFCD03647160
pro_acceptors: 6
pro_donors: 1
pro_smile: c1cc(oc1)CNC(=O)c2ccc(nc2)c3cnn(c3)c4ccc(cc4)Cl
InChi: InChI=1S/C20H15ClN4O2/c21-16-4-6-17(7-5-16)25-13-15(11-24-25)19-8-3-14(10-22-19)20(26)23-12-18-2-1-9-27-18/h1-11,13H,12H2,(H,23,26)
InChiKey: InChIKey=AACYYGYEIDZADK-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.