N-(2-FURYLMETHYL)-6-[1-(2-HYDROXYETHYL)-1H-PYRAZOL-4-YL]NICOTINAMIDE

pro_cas
pro_cdbregno
CCD00402897
pro_formula
C16 H16 N4 O3
pro_molWeight
312.327

basic_info

Product_Name: N-(2-FURYLMETHYL)-6-[1-(2-HYDROXYETHYL)-1H-PYRAZOL-4-YL]NICOTINAMIDE
EnglishSynonyms: N-(2-FURYLMETHYL)-6-[1-(2-HYDROXYETHYL)-1H-PYRAZOL-4-YL]NICOTINAMIDE
pro_mdlNumber: MFCD03647270
pro_acceptors: 7
pro_donors: 2
pro_smile: c1cc(oc1)CNC(=O)c2ccc(nc2)c3cnn(c3)CCO
InChi: InChI=1S/C16H16N4O3/c21-6-5-20-11-13(9-19-20)15-4-3-12(8-17-15)16(22)18-10-14-2-1-7-23-14/h1-4,7-9,11,21H,5-6,10H2,(H,18,22)
InChiKey: InChIKey=RDHOWGDLUJMCTQ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.