DIMETHYL 3-((3-F-ANILINO)CARBONYL)PYRROLO(2,1-A)ISOQUINOLINE-1,2-DICARBOXYLATE

pro_cas
618070-10-3
pro_cdbregno
CCD00431709
pro_formula
C23 H17 F N2 O5
pro_molWeight
420.394

basic_info

Product_Name: DIMETHYL 3-((3-F-ANILINO)CARBONYL)PYRROLO(2,1-A)ISOQUINOLINE-1,2-DICARBOXYLATE
CAS: 618070-10-3
EnglishSynonyms: DIMETHYL 3-((3-F-ANILINO)CARBONYL)PYRROLO(2,1-A)ISOQUINOLINE-1,2-DICARBOXYLATE
pro_mdlNumber: MFCD03932123
pro_acceptors: 7
pro_donors: 1
pro_smile: COC(=O)c1c(c(n2c1c3ccccc3cc2)C(=O)Nc4cccc(c4)F)C(=O)OC
InChi: InChI=1S/C23H17FN2O5/c1-30-22(28)17-18(23(29)31-2)20(21(27)25-15-8-5-7-14(24)12-15)26-11-10-13-6-3-4-9-16(13)19(17)26/h3-12H,1-2H3,(H,25,27)
InChiKey: InChIKey=SJUSGQAOKZPQJK-UHFFFAOYSA-N