DIETHYL 3-ETHYL-2,4-PYRROLIDINEDICARBOXYLATE

pro_cas
pro_cdbregno
CCD00451326
pro_formula
C12 H21 N O4
pro_molWeight
243.301

basic_info

Product_Name: DIETHYL 3-ETHYL-2,4-PYRROLIDINEDICARBOXYLATE
EnglishSynonyms: DIETHYL 3-ETHYL-2,4-PYRROLIDINEDICARBOXYLATE
pro_mdlNumber: MFCD04116255
pro_acceptors: 5
pro_donors: 1
pro_smile: CCC1C(CNC1C(=O)OCC)C(=O)OCC
InChi: InChI=1S/C12H21NO4/c1-4-8-9(11(14)16-5-2)7-13-10(8)12(15)17-6-3/h8-10,13H,4-7H2,1-3H3
InChiKey: InChIKey=YJOBFXWNMDXHNE-UHFFFAOYSA-N

property

secure_info