DIETHYL 5-PHENYL-2,4-PYRROLIDINEDICARBOXYLATE

pro_cas
pro_cdbregno
CCD00451329
pro_formula
C16 H21 N O4
pro_molWeight
291.345

basic_info

Product_Name: DIETHYL 5-PHENYL-2,4-PYRROLIDINEDICARBOXYLATE
EnglishSynonyms: DIETHYL 5-PHENYL-2,4-PYRROLIDINEDICARBOXYLATE
pro_mdlNumber: MFCD04116259
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)C1CC(NC1c2ccccc2)C(=O)OCC
InChi: InChI=1S/C16H21NO4/c1-3-20-15(18)12-10-13(16(19)21-4-2)17-14(12)11-8-6-5-7-9-11/h5-9,12-14,17H,3-4,10H2,1-2H3
InChiKey: InChIKey=UMEGSVOTMKQFSD-UHFFFAOYSA-N

property

secure_info