DIETHYL 5-(4-CHLOROPHENYL)-2,4-PYRROLIDINEDICARBOXYLATE

pro_cas
pro_cdbregno
CCD00451330
pro_formula
C16 H20 Cl N O4
pro_molWeight
325.79

basic_info

Product_Name: DIETHYL 5-(4-CHLOROPHENYL)-2,4-PYRROLIDINEDICARBOXYLATE
EnglishSynonyms: DIETHYL 5-(4-CHLOROPHENYL)-2,4-PYRROLIDINEDICARBOXYLATE
pro_mdlNumber: MFCD04116260
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)C1CC(NC1c2ccc(cc2)Cl)C(=O)OCC
InChi: InChI=1S/C16H20ClNO4/c1-3-21-15(19)12-9-13(16(20)22-4-2)18-14(12)10-5-7-11(17)8-6-10/h5-8,12-14,18H,3-4,9H2,1-2H3
InChiKey: InChIKey=UCSWTVCJCXRJAJ-UHFFFAOYSA-N

property

secure_info