DIMETHYL 1-(3-NITROBENZOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE

pro_cas
pro_cdbregno
CCD00454226
pro_formula
C23 H16 N2 O7
pro_molWeight
432.386

basic_info

Product_Name: DIMETHYL 1-(3-NITROBENZOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
EnglishSynonyms: DIMETHYL 1-(3-NITROBENZOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
pro_mdlNumber: MFCD04119888
pro_acceptors: 9
pro_donors: 0
pro_smile: COC(=O)c1c2ccc3ccccc3n2c(c1C(=O)OC)C(=O)c4cccc(c4)[N+](=O)[O-]
InChi: InChI=1S/C23H16N2O7/c1-31-22(27)18-17-11-10-13-6-3-4-9-16(13)24(17)20(19(18)23(28)32-2)21(26)14-7-5-8-15(12-14)25(29)30/h3-12H,1-2H3
InChiKey: InChIKey=BGMMGFHRDDQWEC-UHFFFAOYSA-N