DIMETHYL 1-(3,4-DIMETHOXYBENZOYL)-7-ME-PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE

pro_cas
pro_cdbregno
CCD00454283
pro_formula
C26 H23 N O7
pro_molWeight
461.468

basic_info

Product_Name: DIMETHYL 1-(3,4-DIMETHOXYBENZOYL)-7-ME-PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
EnglishSynonyms: DIMETHYL 1-(3,4-DIMETHOXYBENZOYL)-7-ME-PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
pro_mdlNumber: MFCD04119945
pro_acceptors: 8
pro_donors: 0
pro_smile: Cc1ccc2c(c1)ccc3n2c(c(c3C(=O)OC)C(=O)OC)C(=O)c4ccc(c(c4)OC)OC
InChi: InChI=1S/C26H23NO7/c1-14-6-9-17-15(12-14)7-10-18-21(25(29)33-4)22(26(30)34-5)23(27(17)18)24(28)16-8-11-19(31-2)20(13-16)32-3/h6-13H,1-5H3
InChiKey: InChIKey=CPSXPDCYXWTEAN-UHFFFAOYSA-N