C9 H6 Cl F3 O2


CAS: 886503-42-0
pro_mdlNumber: MFCD06660315
pro_acceptors: 2
pro_donors: 0
pro_smile: CC(=O)c1cc(cc(c1)Cl)OC(F)(F)F
InChi: InChI=1S/C9H6ClF3O2/c1-5(14)6-2-7(10)4-8(3-6)15-9(11,12)13/h2-4H,1H3


Comments: HAZARD: R 36/37/38
HAZARD: S 26-37


* If the product has intellectual property rights, a license granted is must or contact us.