METHYL 2-AMINO-4-(DIFLUOROMETHOXY)-5-METHOXYBENZOATE

pro_cas
923683-37-8
pro_cdbregno
CCD00645973
pro_formula
C10 H11 F2 N O4
pro_molWeight
247.196

basic_info

Product_Name: METHYL 2-AMINO-4-(DIFLUOROMETHOXY)-5-METHOXYBENZOATE
CAS: 923683-37-8
EnglishSynonyms: METHYL 2-AMINO-4-(DIFLUOROMETHOXY)-5-METHOXYBENZOATE
pro_mdlNumber: MFCD08444622
pro_acceptors: 5
pro_donors: 1
pro_smile: COc1cc(c(cc1OC(F)F)N)C(=O)OC
InChi: InChI=1S/C10H11F2NO4/c1-15-7-3-5(9(14)16-2)6(13)4-8(7)17-10(11)12/h3-4,10H,13H2,1-2H3
InChiKey: InChIKey=QBMXDZDSUDIBEP-UHFFFAOYSA-N