2-(([3-(METHOXYCARBONYL)FURAN-2-YL]METHYL)SULFANYL)BENZOIC ACID

pro_cas
949297-71-6
pro_cdbregno
CCD00947443
pro_formula
C14 H12 O5 S
pro_molWeight
292.31

basic_info

Product_Name: 2-(([3-(METHOXYCARBONYL)FURAN-2-YL]METHYL)SULFANYL)BENZOIC ACID
CAS: 949297-71-6
EnglishSynonyms: 2-(([3-(METHOXYCARBONYL)FURAN-2-YL]METHYL)SULFANYL)BENZOIC ACID
pro_mdlNumber: MFCD10491154
pro_acceptors: 5
pro_donors: 1
pro_smile: COC(=O)c1ccoc1CSc2ccccc2C(=O)O
InChi: InChI=1S/C14H12O5S/c1-18-14(17)9-6-7-19-11(9)8-20-12-5-3-2-4-10(12)13(15)16/h2-7H,8H2,1H3,(H,15,16)
InChiKey: InChIKey=HDMUVDBJZYXSFT-UHFFFAOYSA-N