5-CHLORO-3-(ETHANESULFONYL)-2-FLUOROBENZOIC ACID

pro_cas
pro_cdbregno
CCD01010566
pro_formula
C9 H8 Cl F O4 S
pro_molWeight
266.675

basic_info

Product_Name: 5-CHLORO-3-(ETHANESULFONYL)-2-FLUOROBENZOIC ACID
EnglishSynonyms: 5-CHLORO-3-(ETHANESULFONYL)-2-FLUOROBENZOIC ACID
pro_mdlNumber: MFCD11103033
pro_acceptors: 4
pro_donors: 1
pro_smile: CCS(=O)(=O)c1cc(cc(c1F)C(=O)O)Cl
InChi: InChI=1S/C9H8ClFO4S/c1-2-16(14,15)7-4-5(10)3-6(8(7)11)9(12)13/h3-4H,2H2,1H3,(H,12,13)
InChiKey: InChIKey=YRIYZNPLYZJUJZ-UHFFFAOYSA-N