N-[(5-BROMOTHIOPHEN-2-YL)METHYL]PYRIDIN-3-AMINE

pro_cas
pro_cdbregno
CCD01046593
pro_formula
C10 H9 Br N2 S
pro_molWeight
269.165

basic_info

Product_Name: N-[(5-BROMOTHIOPHEN-2-YL)METHYL]PYRIDIN-3-AMINE
EnglishSynonyms: N-[(5-BROMOTHIOPHEN-2-YL)METHYL]PYRIDIN-3-AMINE
pro_mdlNumber: MFCD11140221
pro_acceptors: 2
pro_donors: 1
pro_smile: c1cc(cnc1)NCc2ccc(s2)Br
InChi: InChI=1S/C10H9BrN2S/c11-10-4-3-9(14-10)7-13-8-2-1-5-12-6-8/h1-6,13H,7H2
InChiKey: InChIKey=NTMCLCWMAWEZAT-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.